cas: 207129-35-9 — see every product listed under this CAS number, including other names
((1S,2S,4S,5R)-5-Vinylquinuclidin-2-yl)methanol, 98%+(GC),RG, 98%+(GC),RG (CAS 207129-35-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113IUV-100mg |
| cas | 207129-35-9 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 659.60 Pln | |
| Chemat | 1g | 1922.00 Pln |
| purity | 98%+(GC),RG |
|---|---|
| delivery time | 3 weeks |
[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanol (CAS 207129-35-9) is a chemical compound with the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. IUPAC name: [(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanol. InChIKey: GAFZBOMPQVRGKU-GUBZILKMSA-N.
| Molecular formula | C10H17NO |
|---|---|
| Molecular weight | 167.25 g/mol |
| IUPAC name | [(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanol |
| InChIKey | GAFZBOMPQVRGKU-GUBZILKMSA-N |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2CO |
Computed by PubChem (NCBI)