Products 207129-36-0
CAS 207129-36-0 appears in our catalog under these names: Quincoridine, 95%, Quincoridine, >95.0%(GC), (1S,2R,4S,5R)-5-Ethenyl-1-azabicyclo[2.2.2]octane-2-methanol, 95.0%, 95.0%. Offered by: Combi-blocks, TCI, Chemat. Available pack sizes: 100mg, 1g.
[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanol (CAS 207129-36-0) is a chemical compound with the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. IUPAC name: [(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanol. InChIKey: GAFZBOMPQVRGKU-LPEHRKFASA-N.
| Molecular formula | C10H17NO |
|---|---|
| Molecular weight | 167.25 g/mol |
| IUPAC name | [(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanol |
| InChIKey | GAFZBOMPQVRGKU-LPEHRKFASA-N |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2CO |
Computed by PubChem (NCBI)