cas: 23582-02-7 — see every product listed under this CAS number, including other names
((Phenylphosphinediyl)bis(ethane-2,1-diyl))bis(diphenylphosphine) 97% (CAS 23582-02-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A776375-250mg |
| cas | 23582-02-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 815.38 Pln | |
| Ambeed | 5g | 3112.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A776375 |
Bis(2-diphenylphosphanylethyl)-phenylphosphane (CAS 23582-02-7) is a chemical compound with the molecular formula C34H33P3 and a molecular weight of 534.5 g/mol. IUPAC name: bis(2-diphenylphosphanylethyl)-phenylphosphane. InChIKey: AXVOAMVQOCBPQT-UHFFFAOYSA-N.
| Molecular formula | C34H33P3 |
|---|---|
| Molecular weight | 534.5 g/mol |
| IUPAC name | bis(2-diphenylphosphanylethyl)-phenylphosphane |
| InChIKey | AXVOAMVQOCBPQT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(CCP(C2=CC=CC=C2)C3=CC=CC=C3)CCP(C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)