(+)-Camphanic acid chloride, 95%, 95%
cas: 104530-16-7 — see every product listed under this CAS number, including other names
(+)-Camphanic acid chloride, 95%, 95% (CAS 104530-16-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118XT4-100mg |
| cas | 104530-16-7 |
| size | 100mg |
| availability | 2g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 1g | 1163.60 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(1R,4S)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl chloride (CAS 104530-16-7) is a chemical compound with the molecular formula C10H13ClO3 and a molecular weight of 216.66 g/mol. IUPAC name: (1R,4S)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl chloride. InChIKey: PAXWODJTHKJQDZ-ZJUUUORDSA-N.
| Molecular formula | C10H13ClO3 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | (1R,4S)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl chloride |
| InChIKey | PAXWODJTHKJQDZ-ZJUUUORDSA-N |
| SMILES | C[C@]12CC[C@](C1(C)C)(OC2=O)C(=O)Cl |
Computed by PubChem (NCBI)