Products 104530-16-7
CAS 104530-16-7 appears in our catalog under these names: (+)-Camphanic acid chloride, 95%, (+)-Camphanic acid chloride, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg.
(1R,4S)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl chloride (CAS 104530-16-7) is a chemical compound with the molecular formula C10H13ClO3 and a molecular weight of 216.66 g/mol. IUPAC name: (1R,4S)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl chloride. InChIKey: PAXWODJTHKJQDZ-ZJUUUORDSA-N.
| Molecular formula | C10H13ClO3 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | (1R,4S)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl chloride |
| InChIKey | PAXWODJTHKJQDZ-ZJUUUORDSA-N |
| SMILES | C[C@]12CC[C@](C1(C)C)(OC2=O)C(=O)Cl |
Computed by PubChem (NCBI)