cas: 23283-97-8 — see every product listed under this CAS number, including other names
(+)-Isomenthol, 97.00% (CAS 23283-97-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM18460K-100mg |
| cas | 23283-97-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 842.53 Pln | |
| Chemat | 25mg | 380.46 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 97.00% |
| category | Chemicals |
(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexan-1-ol (CAS 23283-97-8) is a chemical compound with the molecular formula C10H20O and a molecular weight of 156.26 g/mol. IUPAC name: (1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexan-1-ol. InChIKey: NOOLISFMXDJSKH-BBBLOLIVSA-N.
| Molecular formula | C10H20O |
|---|---|
| Molecular weight | 156.26 g/mol |
| IUPAC name | (1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexan-1-ol |
| InChIKey | NOOLISFMXDJSKH-BBBLOLIVSA-N |
| SMILES | C[C@@H]1CC[C@@H]([C@H](C1)O)C(C)C |
Computed by PubChem (NCBI)