Products 20747-49-3
CAS 20747-49-3 appears in our catalog under these names: Emtricitabine Impurity 11, Emtricitabine Impurity 38, Emtricitabine Impurity 40, Neomenthol. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexan-1-ol (CAS 20747-49-3) is a chemical compound with the molecular formula C10H20O and a molecular weight of 156.26 g/mol. IUPAC name: (1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexan-1-ol. InChIKey: NOOLISFMXDJSKH-IVZWLZJFSA-N.
| Molecular formula | C10H20O |
|---|---|
| Molecular weight | 156.26 g/mol |
| IUPAC name | (1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexan-1-ol |
| InChIKey | NOOLISFMXDJSKH-IVZWLZJFSA-N |
| SMILES | C[C@H]1CC[C@@H]([C@@H](C1)O)C(C)C |
Computed by PubChem (NCBI)