(+)-Sparteine, 97%
cas: 492-08-0 — see every product listed under this CAS number, including other names
(+)-Sparteine, 97% (CAS 492-08-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A135377-250mg |
| cas | 492-08-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 387.06 Pln | |
| Ambeed | 10g | 676.31 Pln | |
| Ambeed | 25g | 1532.94 Pln | |
| Ambeed | 100g | 5599.12 Pln | |
| Chemat | 5g | 462.80 Pln | |
| Chemat | 10g | 861.20 Pln | |
| Chemat | 25g | 2046.80 Pln | |
| Chemat | 100g | 7984.40 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(1R,2S,9R,10R)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane (CAS 492-08-0) is a chemical compound with the molecular formula C15H26N2 and a molecular weight of 234.38 g/mol. IUPAC name: (1R,2S,9R,10R)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane. InChIKey: SLRCCWJSBJZJBV-TUVASFSCSA-N.
| Molecular formula | C15H26N2 |
|---|---|
| Molecular weight | 234.38 g/mol |
| IUPAC name | (1R,2S,9R,10R)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane |
| InChIKey | SLRCCWJSBJZJBV-TUVASFSCSA-N |
| SMILES | C1CCN2C[C@H]3C[C@@H]([C@H]2C1)CN4[C@H]3CCCC4 |
Computed by PubChem (NCBI)
Synonyms:
(+)-Sparteine, Pachycarpine, d-Sparteine, Sparteine, d-isomer, 6-alpha,7-beta,9-beta,11-beta-Sparteine, (1R,2S,9R,10R)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane, 5-23-05-00497 (Beilstein Handbook Reference), (1R,2S,9R,10R)-7,15-diazatetracyclo(7.7.1.02,7.010,15)heptadecane, lupinidine, Tocosamine (Sulfate pentahydrate)