Products 492-08-0
CAS 492-08-0 appears in our catalog under these names: Pachycarpine, 97%, (+)-Sparteine, >95% (HPLC), (+)-Sparteine/ 99.9%, (+)-Sparteine, >98.0%(GC), (+)-Sparteine. Offered by: Combi-blocks, TRC, TargetMol, TCI, Biosynth. Available pack sizes: 100g, 5g, 25g, 1g, 100mg, 10mg, 50mg, 10g.
(1R,2S,9R,10R)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane (CAS 492-08-0) is a chemical compound with the molecular formula C15H26N2 and a molecular weight of 234.38 g/mol. IUPAC name: (1R,2S,9R,10R)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane. InChIKey: SLRCCWJSBJZJBV-TUVASFSCSA-N.
| Molecular formula | C15H26N2 |
|---|---|
| Molecular weight | 234.38 g/mol |
| IUPAC name | (1R,2S,9R,10R)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane |
| InChIKey | SLRCCWJSBJZJBV-TUVASFSCSA-N |
| SMILES | C1CCN2C[C@H]3C[C@@H]([C@H]2C1)CN4[C@H]3CCCC4 |
Computed by PubChem (NCBI)
Synonyms:
(+)-Sparteine, Pachycarpine, d-Sparteine, Sparteine, d-isomer, 6-alpha,7-beta,9-beta,11-beta-Sparteine, (1R,2S,9R,10R)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane, 5-23-05-00497 (Beilstein Handbook Reference), (1R,2S,9R,10R)-7,15-diazatetracyclo(7.7.1.02,7.010,15)heptadecane, lupinidine, Tocosamine (Sulfate pentahydrate)