CAS 56614-57-4 appears in our catalog under these names: (1R,2S,3R,4S)-1,7,7-Trimethylbicyclo[2.2.1]heptane-2,3-diol, 95%, (+/-)-EXO,EXO-2,3-CAMPHANEDIOL. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 5g, 1g.
(1R,2S,3R,4S)-1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-diol (CAS 56614-57-4) is a chemical compound with the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. IUPAC name: (1R,2S,3R,4S)-1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-diol. InChIKey: AYEOSGBMQHXVER-DQUBFYRCSA-N.
| Molecular formula | C10H18O2 |
|---|---|
| Molecular weight | 170.25 g/mol |
| IUPAC name | (1R,2S,3R,4S)-1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-diol |
| InChIKey | AYEOSGBMQHXVER-DQUBFYRCSA-N |
| SMILES | C[C@@]12CC[C@@H](C1(C)C)[C@H]([C@H]2O)O |
Computed by PubChem (NCBI)