Products 7429-37-0
CAS 7429-37-0 appears in our catalog under these names: Trans-1,2-dibromocyclohexane, 95%, (+/–)–trans–1，2–Dibromocyclohexane, trans-1,2-Dibromocyclohexane, (+/-)-trans-1,2-Dibromocyclohexane, >95.0%(GC), trans-1,2-Dibromocyclohexane 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, TCI. Available pack sizes: 25g, 1g, 5g, 500g, 100g, 10g.
Trans-(1R,2R)-1,2-dibromocyclohexane (CAS 7429-37-0) is a chemical compound with the molecular formula C6H10Br2 and a molecular weight of 241.95 g/mol. IUPAC name: trans-(1R,2R)-1,2-dibromocyclohexane. InChIKey: CZNHKZKWKJNOTE-PHDIDXHHSA-N.
| Molecular formula | C6H10Br2 |
|---|---|
| Molecular weight | 241.95 g/mol |
| IUPAC name | trans-(1R,2R)-1,2-dibromocyclohexane |
| InChIKey | CZNHKZKWKJNOTE-PHDIDXHHSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)Br)Br |
Computed by PubChem (NCBI)