cas: 73346-74-4 — see every product listed under this CAS number, including other names
(-)-2,3-O-Isopropylidene-D-threitol, >98.0%(GC) (CAS 73346-74-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | I0375-1G |
| cas | 73346-74-4 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 403.55 Pln | |
| TCI | 5g | 1347.66 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
[(4R,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol (CAS 73346-74-4) is a chemical compound with the molecular formula C7H14O4 and a molecular weight of 162.18 g/mol. IUPAC name: [(4R,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol. InChIKey: INVRLGIKFANLFP-PHDIDXHHSA-N.
| Molecular formula | C7H14O4 |
|---|---|
| Molecular weight | 162.18 g/mol |
| IUPAC name | [(4R,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
| InChIKey | INVRLGIKFANLFP-PHDIDXHHSA-N |
| SMILES | CC1(O[C@@H]([C@H](O1)CO)CO)C |
Computed by PubChem (NCBI)