CAS 55904-12-6 is the registry number for cis-2,2-Dimethyl-1,3-dioxolane-4,5-diyl)dimethanol. Offered by: TRC. Available pack sizes: 2,5g.
[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol (CAS 55904-12-6) is a chemical compound with the molecular formula C7H14O4 and a molecular weight of 162.18 g/mol. IUPAC name: [(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol. InChIKey: INVRLGIKFANLFP-OLQVQODUSA-N.
| Molecular formula | C7H14O4 |
|---|---|
| Molecular weight | 162.18 g/mol |
| IUPAC name | [(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
| InChIKey | INVRLGIKFANLFP-OLQVQODUSA-N |
| SMILES | CC1(O[C@@H]([C@@H](O1)CO)CO)C |
Computed by PubChem (NCBI)