cas: 2216-51-5 — see every product listed under this CAS number, including other names
(-)-Menthol 99+% (CAS 2216-51-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A140621-10g |
| cas | 2216-51-5 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 192.38 Pln | |
| Ambeed | 25g | 203.50 Pln | |
| Ambeed | 100g | 220.19 Pln | |
| Ambeed | 500g | 337.00 Pln | |
| Ambeed | 1000g | 481.62 Pln |
| purity | 99+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A140621 |
(-)-menthol is a p-menthan-3-ol which has (1R,2S,5R)-stereochemistry. It is the most common naturally occurring enantiomer. It has a role as an antitussive, an antispasmodic drug and an antipruritic drug. It is an enantiomer of a (+)-menthol.
Source: ChEBI
| Molecular formula | C10H20O |
|---|---|
| Molecular weight | 156.26 g/mol |
| IUPAC name | (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-ol |
| InChIKey | NOOLISFMXDJSKH-KXUCPTDWSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)O)C(C)C |
Computed by PubChem (NCBI)