(1,2-Bis(ethoxycarbonyl)hydrazineyl)triphenylphosphonium trifluoromethanesulfonate, 98%
cas: 3075704-21-8 — see every product listed under this CAS number, including other names
(1,2-Bis(ethoxycarbonyl)hydrazineyl)triphenylphosphonium trifluoromethanesulfonate, 98% (CAS 3075704-21-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg, 50g. Offered by: BLDpharm, Chemat.
| brand | BLDpharm |
|---|---|
| catalog number | BD02725687-1g |
| cas | 3075704-21-8 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 292.14 Pln | |
| BLDpharm | 10g | 453.20 Pln | |
| BLDpharm | 25g | 825.29 Pln | |
| BLDpharm | 100g | 1619.45 Pln | |
| BLDpharm | 500g | 5490.31 Pln | |
| BLDpharm | 1kg | 9322.30 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 10g | 213.20 Pln | |
| Chemat | 25g | 371.60 Pln | |
| Chemat | 50g | 544.40 Pln | |
| Chemat | 100g | 890.00 Pln | |
| Chemat | 250g | 1782.80 Pln | |
| Chemat | 500g | 2889.60 Pln | |
| Chemat | 5kg | 14496.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
[ethoxycarbonyl-(ethoxycarbonylamino)amino]-triphenylphosphanium;trifluoromethanesulfonate (CAS 3075704-21-8) is a chemical compound with the molecular formula C25H26F3N2O7PS and a molecular weight of 586.5 g/mol. IUPAC name: [ethoxycarbonyl-(ethoxycarbonylamino)amino]-triphenylphosphanium;trifluoromethanesulfonate. InChIKey: HYMHTRAMEOGPDA-UHFFFAOYSA-N.
| Molecular formula | C25H26F3N2O7PS |
|---|---|
| Molecular weight | 586.5 g/mol |
| IUPAC name | [ethoxycarbonyl-(ethoxycarbonylamino)amino]-triphenylphosphanium;trifluoromethanesulfonate |
| InChIKey | HYMHTRAMEOGPDA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NN(C(=O)OCC)[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.C(F)(F)(F)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)
