7-(Bromomethyl)isoquinoline hydrobromide, 95%
cas: 1203372-02-4 — see every product listed under this CAS number, including other names
7-(Bromomethyl)isoquinoline hydrobromide, 95% (CAS 1203372-02-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A178703-100mg |
| cas | 1203372-02-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 470.50 Pln | |
| Ambeed | 250mg | 965.56 Pln | |
| Ambeed | 1g | 1922.31 Pln | |
| Ambeed | 5g | 9326.00 Pln | |
| Chemat | 100mg | 606.80 Pln | |
| Chemat | 250mg | 1024.40 Pln | |
| Chemat | 1g | 2560.40 Pln | |
| BLDpharm | 100mg | 503.18 Pln | |
| BLDpharm | 250mg | 1036.33 Pln | |
| BLDpharm | 1g | 2069.30 Pln | |
| BLDpharm | 5g | 9799.91 Pln | |
| Fluorochem | 250mg | 1893.10 Pln | |
| Fluorochem | 1g | 4741.06 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
7-(bromomethyl)isoquinoline;hydrobromide (CAS 1203372-02-4) is a chemical compound with the molecular formula C10H9Br2N and a molecular weight of 302.99 g/mol. IUPAC name: 7-(bromomethyl)isoquinoline;hydrobromide. InChIKey: ILUMYCASODISJM-UHFFFAOYSA-N.
| Molecular formula | C10H9Br2N |
|---|---|
| Molecular weight | 302.99 g/mol |
| IUPAC name | 7-(bromomethyl)isoquinoline;hydrobromide |
| InChIKey | ILUMYCASODISJM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CN=C2)CBr.Br |
Computed by PubChem (NCBI)