cas: 2225178-71-0 — see every product listed under this CAS number, including other names
(1-(3-(Trifluoromethyl)phenyl)-1H-pyrazol-4-yl)boronic acid 96% (CAS 2225178-71-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A997411-100mg |
| cas | 2225178-71-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 448.25 Pln | |
| Ambeed | 250mg | 698.56 Pln | |
| Ambeed | 1g | 1744.31 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A997411 |
[1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]boronic acid (CAS 2225178-71-0) is a chemical compound with the molecular formula C10H8BF3N2O2 and a molecular weight of 255.99 g/mol. IUPAC name: [1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]boronic acid. InChIKey: ADHPVFRVUDFITR-UHFFFAOYSA-N.
| Molecular formula | C10H8BF3N2O2 |
|---|---|
| Molecular weight | 255.99 g/mol |
| IUPAC name | [1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]boronic acid |
| InChIKey | ADHPVFRVUDFITR-UHFFFAOYSA-N |
| SMILES | B(C1=CN(N=C1)C2=CC=CC(=C2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)