CAS 2225178-71-0 appears in our catalog under these names: 1-(3-Trifluoromethylphenyl)-1h-pyrazole-4-boronic acid, 96%, {1-(3-(Trifluoromethyl)phenyl)-1H-pyrazol-4-yl}boronic acid, (1-(3-(Trifluoromethyl)phenyl)-1H-pyrazol-4-yl)boronic acid 96%, 1-(3-Trifluoromethylphenyl)-1h-pyrazole-4-boronic acid, 96%, 96%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg.
[1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]boronic acid (CAS 2225178-71-0) is a chemical compound with the molecular formula C10H8BF3N2O2 and a molecular weight of 255.99 g/mol. IUPAC name: [1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]boronic acid. InChIKey: ADHPVFRVUDFITR-UHFFFAOYSA-N.
| Molecular formula | C10H8BF3N2O2 |
|---|---|
| Molecular weight | 255.99 g/mol |
| IUPAC name | [1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]boronic acid |
| InChIKey | ADHPVFRVUDFITR-UHFFFAOYSA-N |
| SMILES | B(C1=CN(N=C1)C2=CC=CC(=C2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)