cas: 1162261-97-3 — see every product listed under this CAS number, including other names
(1-(tert-Butoxycarbonyl)-1H-pyrazol-3-yl)boronic acid (CAS 1162261-97-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F337587-100MG |
| cas | 1162261-97-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1169.40 Pln | |
| Fluorochem | 250mg | 1716.08 Pln | |
| Fluorochem | 1g | 4465.11 Pln |
| delivery time | 3-4 weeks |
|---|
[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrazol-3-yl]boronic acid (CAS 1162261-97-3) is a chemical compound with the molecular formula C8H13BN2O4 and a molecular weight of 212.01 g/mol. IUPAC name: [1-[(2-methylpropan-2-yl)oxycarbonyl]pyrazol-3-yl]boronic acid. InChIKey: WYFZWYIHBPVOPY-UHFFFAOYSA-N.
| Molecular formula | C8H13BN2O4 |
|---|---|
| Molecular weight | 212.01 g/mol |
| IUPAC name | [1-[(2-methylpropan-2-yl)oxycarbonyl]pyrazol-3-yl]boronic acid |
| InChIKey | WYFZWYIHBPVOPY-UHFFFAOYSA-N |
| SMILES | B(C1=NN(C=C1)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)