CAS 1162261-97-3 is the registry number for 1-tert-Butyloxycarbonyl-pyrazole-3-boric acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 5g, 1g, 250mg.
[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrazol-3-yl]boronic acid (CAS 1162261-97-3) is a chemical compound with the molecular formula C8H13BN2O4 and a molecular weight of 212.01 g/mol. IUPAC name: [1-[(2-methylpropan-2-yl)oxycarbonyl]pyrazol-3-yl]boronic acid. InChIKey: WYFZWYIHBPVOPY-UHFFFAOYSA-N.
| Molecular formula | C8H13BN2O4 |
|---|---|
| Molecular weight | 212.01 g/mol |
| IUPAC name | [1-[(2-methylpropan-2-yl)oxycarbonyl]pyrazol-3-yl]boronic acid |
| InChIKey | WYFZWYIHBPVOPY-UHFFFAOYSA-N |
| SMILES | B(C1=NN(C=C1)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)