cas: 1188405-87-9 — see every product listed under this CAS number, including other names
(1-(tert-Butoxycarbonyl)-1H-pyrazol-4-yl)boronic acid, 98%, 98% (CAS 1188405-87-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119SIT-250mg |
| cas | 1188405-87-9 |
| size | 250mg |
| availability | 600g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 189.20 Pln | |
| Chemat | 10g | 304.40 Pln | |
| Chemat | 25g | 635.60 Pln | |
| Chemat | 100g | 1955.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrazol-4-yl]boronic acid (CAS 1188405-87-9) is a chemical compound with the molecular formula C8H13BN2O4 and a molecular weight of 212.01 g/mol. IUPAC name: [1-[(2-methylpropan-2-yl)oxycarbonyl]pyrazol-4-yl]boronic acid. InChIKey: IUEPVMMFUSDDBJ-UHFFFAOYSA-N.
| Molecular formula | C8H13BN2O4 |
|---|---|
| Molecular weight | 212.01 g/mol |
| IUPAC name | [1-[(2-methylpropan-2-yl)oxycarbonyl]pyrazol-4-yl]boronic acid |
| InChIKey | IUEPVMMFUSDDBJ-UHFFFAOYSA-N |
| SMILES | B(C1=CN(N=C1)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)