cas: 1217500-54-3 — see every product listed under this CAS number, including other names
(1-(tert-Butoxycarbonyl)-1H-pyrazol-5-yl)boronic acid, 97%, 97% (CAS 1217500-54-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1126PE-25g |
| cas | 1217500-54-3 |
| size | 25g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 1576.40 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 386.00 Pln | |
| Chemat | 10g | 707.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[2-[(2-methylpropan-2-yl)oxycarbonyl]pyrazol-3-yl]boronic acid (CAS 1217500-54-3) is a chemical compound with the molecular formula C8H13BN2O4 and a molecular weight of 212.01 g/mol. IUPAC name: [2-[(2-methylpropan-2-yl)oxycarbonyl]pyrazol-3-yl]boronic acid. InChIKey: BMAIJKCROWPJPY-UHFFFAOYSA-N.
| Molecular formula | C8H13BN2O4 |
|---|---|
| Molecular weight | 212.01 g/mol |
| IUPAC name | [2-[(2-methylpropan-2-yl)oxycarbonyl]pyrazol-3-yl]boronic acid |
| InChIKey | BMAIJKCROWPJPY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=NN1C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)