cas: 352359-21-8 — see every product listed under this CAS number, including other names
(1-(tert-Butoxycarbonyl)-4-methyl-1H-indol-2-yl)boronic acid, 97% (CAS 352359-21-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212631-1G |
| cas | 352359-21-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 466.52 Pln | |
| Fluorochem | 5g | 1507.82 Pln | |
| Fluorochem | 10g | 2070.12 Pln | |
| Fluorochem | 25g | 4371.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid (CAS 352359-21-8) is a chemical compound with the molecular formula C14H18BNO4 and a molecular weight of 275.11 g/mol. IUPAC name: [4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid. InChIKey: ZJNLBPIVJPNKSK-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO4 |
|---|---|
| Molecular weight | 275.11 g/mol |
| IUPAC name | [4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
| InChIKey | ZJNLBPIVJPNKSK-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=CC=C2N1C(=O)OC(C)(C)C)C)(O)O |
Computed by PubChem (NCBI)