CAS 1809200-96-1 appears in our catalog under these names: 2-Oxo-2,4-dihydrobenzo[d][1,3]oxazine-7-boronic acid pinacol ester, 95%, 2-Oxo-2,4-dihydrobenzo(d)(1,3)oxazine-7-boronic Acid Pinacol Ester, 98%, 2-Oxo-2,4-dihydrobenzo(d)(1,3)oxazine-7-boronic Acid Pinacol Ester. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 5g, 100mg.
7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,4-dihydro-3,1-benzoxazin-2-one (CAS 1809200-96-1) is a chemical compound with the molecular formula C14H18BNO4 and a molecular weight of 275.11 g/mol. IUPAC name: 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,4-dihydro-3,1-benzoxazin-2-one. InChIKey: KRGNSDCMLGNQPS-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO4 |
|---|---|
| Molecular weight | 275.11 g/mol |
| IUPAC name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,4-dihydro-3,1-benzoxazin-2-one |
| InChIKey | KRGNSDCMLGNQPS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(COC(=O)N3)C=C2 |
Computed by PubChem (NCBI)