cas: 475102-14-8 — see every product listed under this CAS number, including other names
(1-(tert-Butoxycarbonyl)-5-methyl-1H-indol-2-yl)boronic acid 98% (CAS 475102-14-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A464890-250mg |
| cas | 475102-14-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 631.81 Pln | |
| Ambeed | 5g | 1933.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A464890 |
[5-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid (CAS 475102-14-8) is a chemical compound with the molecular formula C14H18BNO4 and a molecular weight of 275.11 g/mol. IUPAC name: [5-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid. InChIKey: PEOOUPNYKOKTRH-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO4 |
|---|---|
| Molecular weight | 275.11 g/mol |
| IUPAC name | [5-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
| InChIKey | PEOOUPNYKOKTRH-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=CC(=C2)C)(O)O |
Computed by PubChem (NCBI)