cas: 475102-14-8 — see every product listed under this CAS number, including other names
(1-(tert-Butoxycarbonyl)-5-methyl-1H-indol-2-yl)boronic acid, 95% (CAS 475102-14-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212633-100MG |
| cas | 475102-14-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 247.85 Pln | |
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 622.72 Pln | |
| Fluorochem | 2.5g | 1346.42 Pln | |
| Fluorochem | 5g | 1934.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
[5-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid (CAS 475102-14-8) is a chemical compound with the molecular formula C14H18BNO4 and a molecular weight of 275.11 g/mol. IUPAC name: [5-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid. InChIKey: PEOOUPNYKOKTRH-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO4 |
|---|---|
| Molecular weight | 275.11 g/mol |
| IUPAC name | [5-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
| InChIKey | PEOOUPNYKOKTRH-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=CC(=C2)C)(O)O |
Computed by PubChem (NCBI)