cas: 2304634-13-5 — see every product listed under this CAS number, including other names
(1-Cyclopentyl-3-(trifluoromethyl)-1H-pyrazol-4-yl)boronic acid 95% (CAS 2304634-13-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A130762-100mg |
| cas | 2304634-13-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 492.75 Pln | |
| Ambeed | 250mg | 776.44 Pln | |
| Ambeed | 1g | 1833.31 Pln | |
| Ambeed | 5g | 5888.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A130762 |
[1-cyclopentyl-3-(trifluoromethyl)pyrazol-4-yl]boronic acid (CAS 2304634-13-5) is a chemical compound with the molecular formula C9H12BF3N2O2 and a molecular weight of 248.01 g/mol. IUPAC name: [1-cyclopentyl-3-(trifluoromethyl)pyrazol-4-yl]boronic acid. InChIKey: JFERHZBESSKOMR-UHFFFAOYSA-N.
| Molecular formula | C9H12BF3N2O2 |
|---|---|
| Molecular weight | 248.01 g/mol |
| IUPAC name | [1-cyclopentyl-3-(trifluoromethyl)pyrazol-4-yl]boronic acid |
| InChIKey | JFERHZBESSKOMR-UHFFFAOYSA-N |
| SMILES | B(C1=CN(N=C1C(F)(F)F)C2CCCC2)(O)O |
Computed by PubChem (NCBI)