CAS 2304634-13-5 appears in our catalog under these names: 1-Cyclopentyl-3-(trifluoromethyl)pyrazole-4-boronic acid, 97%, (1-Cyclopentyl-3-(trifluoromethyl)-1H-pyrazol-4-yl)boronic acid 95%, 1-CYCLOPENTYL-3-(TRIFLUOROMETHYL)PYRAZOLE-4-BORONIC ACID, 95%, 95%, (1-Cyclopentyl-3-(trifluoromethyl)-1H-pyrazol-4-yl)boronic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
[1-cyclopentyl-3-(trifluoromethyl)pyrazol-4-yl]boronic acid (CAS 2304634-13-5) is a chemical compound with the molecular formula C9H12BF3N2O2 and a molecular weight of 248.01 g/mol. IUPAC name: [1-cyclopentyl-3-(trifluoromethyl)pyrazol-4-yl]boronic acid. InChIKey: JFERHZBESSKOMR-UHFFFAOYSA-N.
| Molecular formula | C9H12BF3N2O2 |
|---|---|
| Molecular weight | 248.01 g/mol |
| IUPAC name | [1-cyclopentyl-3-(trifluoromethyl)pyrazol-4-yl]boronic acid |
| InChIKey | JFERHZBESSKOMR-UHFFFAOYSA-N |
| SMILES | B(C1=CN(N=C1C(F)(F)F)C2CCCC2)(O)O |
Computed by PubChem (NCBI)