cas: 1803179-52-3 — see every product listed under this CAS number, including other names
(1-Phenyl-1,3-benzodiazol-5-yl)boronic acid, 98%, 98% (CAS 1803179-52-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I129-100mg |
| cas | 1803179-52-3 |
| size | 100mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 760.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(1-phenylbenzimidazol-5-yl)boronic acid (CAS 1803179-52-3) is a chemical compound with the molecular formula C13H11BN2O2 and a molecular weight of 238.05 g/mol. IUPAC name: (1-phenylbenzimidazol-5-yl)boronic acid. InChIKey: SNTPKDXAJMSHAK-UHFFFAOYSA-N.
| Molecular formula | C13H11BN2O2 |
|---|---|
| Molecular weight | 238.05 g/mol |
| IUPAC name | (1-phenylbenzimidazol-5-yl)boronic acid |
| InChIKey | SNTPKDXAJMSHAK-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)N(C=N2)C3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)