CAS 607740-02-3 appears in our catalog under these names: (4-(Imidazo[1,2-a]pyridin-2-yl)phenyl)boronic acid, 95%, (4-(Imidazo[1,2-a]pyridin-2-yl)phenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 1g, 100mg, 250mg.
(4-imidazo[1,2-a]pyridin-2-ylphenyl)boronic acid (CAS 607740-02-3) is a chemical compound with the molecular formula C13H11BN2O2 and a molecular weight of 238.05 g/mol. IUPAC name: (4-imidazo[1,2-a]pyridin-2-ylphenyl)boronic acid. InChIKey: IXSWJPRIIKFPBZ-UHFFFAOYSA-N.
| Molecular formula | C13H11BN2O2 |
|---|---|
| Molecular weight | 238.05 g/mol |
| IUPAC name | (4-imidazo[1,2-a]pyridin-2-ylphenyl)boronic acid |
| InChIKey | IXSWJPRIIKFPBZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CN3C=CC=CC3=N2)(O)O |
Computed by PubChem (NCBI)