cas: 2420-56-6 — see every product listed under this CAS number, including other names
(10E,12Z)-Octadeca-10,12-dienoic acid, 80% (isomers mixture) (CAS 2420-56-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1kg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A326629-25g |
| cas | 2420-56-6 |
| size | 25g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 125.62 Pln | |
| Ambeed | 100g | 175.69 Pln | |
| Ambeed | 500g | 414.88 Pln | |
| Ambeed | 1kg | 676.31 Pln | |
| BLDpharm | 25g | 131.09 Pln | |
| BLDpharm | 100g | 153.30 Pln | |
| BLDpharm | 500g | 408.77 Pln | |
| BLDpharm | 1kg | 669.79 Pln |
| purity | 80% (isomers mixture) |
|---|---|
| delivery time | 1-2 weeks |
(10E,12Z)-octadeca-10,12-dienoic acid (CAS 2420-56-6) is a chemical compound with the molecular formula C18H32O2 and a molecular weight of 280.4 g/mol. IUPAC name: (10E,12Z)-octadeca-10,12-dienoic acid. InChIKey: GKJZMAHZJGSBKD-NMMTYZSQSA-N.
| Molecular formula | C18H32O2 |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | (10E,12Z)-octadeca-10,12-dienoic acid |
| InChIKey | GKJZMAHZJGSBKD-NMMTYZSQSA-N |
| SMILES | CCCCC/C=C\C=C\CCCCCCCCC(=O)O |
Computed by PubChem (NCBI)