(11bR)-4-Hydroxy-2,6-bis(2,4,6-trimethylphenyl)-4-oxide-dinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin, 97%
cas: 695162-87-9 — see every product listed under this CAS number, including other names
(11bR)-4-Hydroxy-2,6-bis(2,4,6-trimethylphenyl)-4-oxide-dinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin, 97% (CAS 695162-87-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11ILUH-50mg |
| cas | 695162-87-9 |
| size | 50mg |
| availability | 15g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 266.00 Pln | |
| Chemat | 100mg | 309.20 Pln | |
| Chemat | 250mg | 520.40 Pln | |
| Chemat | 1g | 1552.40 Pln | |
| Chemat | 5g | 5512.40 Pln | |
| Fluorochem | 5g | 13675.41 Pln | |
| Fluorochem | 50mg | 435.28 Pln | |
| Fluorochem | 100mg | 612.30 Pln | |
| Fluorochem | 250mg | 1070.47 Pln | |
| Fluorochem | 1g | 4022.56 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
13-hydroxy-10,16-bis(2,4,6-trimethylphenyl)-12,14-dioxa-13lambda5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide (CAS 695162-87-9) is a chemical compound with the molecular formula C38H33O4P and a molecular weight of 584.6 g/mol. IUPAC name: 13-hydroxy-10,16-bis(2,4,6-trimethylphenyl)-12,14-dioxa-13lambda5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide. InChIKey: BEHLZZISBCRGSO-UHFFFAOYSA-N.
| Molecular formula | C38H33O4P |
|---|---|
| Molecular weight | 584.6 g/mol |
| IUPAC name | 13-hydroxy-10,16-bis(2,4,6-trimethylphenyl)-12,14-dioxa-13lambda5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide |
| InChIKey | BEHLZZISBCRGSO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C2=CC3=CC=CC=C3C4=C2OP(=O)(OC5=C4C6=CC=CC=C6C=C5C7=C(C=C(C=C7C)C)C)O)C |
Computed by PubChem (NCBI)