cas: 1985605-59-1 — see every product listed under this CAS number, including other names
(12aR)-12-[(11S)-7,8-Difluoro-6,11-dihydrodibenzo[b,e]thiepin-11-yl]-3,4,12,12a-tetrahydro-7-hydroxy-1H-[1,4]oxazino[3,4-c]pyrido[2,1-f][1,2,4]triazine-6,8-dione, 97%, 97% (CAS 1985605-59-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EORA-5g |
| cas | 1985605-59-1 |
| size | 5g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 4283.60 Pln | |
| Chemat | 10g | 6813.20 Pln | |
| Chemat | 100mg | 280.40 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 1048.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-11-hydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione (CAS 1985605-59-1) is a chemical compound with the molecular formula C24H19F2N3O4S and a molecular weight of 483.5 g/mol. IUPAC name: (3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-11-hydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione. InChIKey: FIDLLEYNNRGVFR-CTNGQTDRSA-N.
| Molecular formula | C24H19F2N3O4S |
|---|---|
| Molecular weight | 483.5 g/mol |
| IUPAC name | (3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-11-hydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
| InChIKey | FIDLLEYNNRGVFR-CTNGQTDRSA-N |
| SMILES | C1COC[C@@H]2N1C(=O)C3=C(C(=O)C=CN3N2[C@H]4C5=C(CSC6=CC=CC=C46)C(=C(C=C5)F)F)O |
Computed by PubChem (NCBI)