Baloxavir 97%
cas: 1985605-59-1 — see every product listed under this CAS number, including other names
Baloxavir 97% (CAS 1985605-59-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1145224-10g |
| cas | 1985605-59-1 |
| size | 10g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 6733.88 Pln | |
| Ambeed | 100mg | 437.12 Pln | |
| Ambeed | 250mg | 620.69 Pln | |
| Ambeed | 1g | 1460.62 Pln | |
| Ambeed | 5g | 4236.31 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1145224 |
(3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-11-hydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione (CAS 1985605-59-1) is a chemical compound with the molecular formula C24H19F2N3O4S and a molecular weight of 483.5 g/mol. IUPAC name: (3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-11-hydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione. InChIKey: FIDLLEYNNRGVFR-CTNGQTDRSA-N.
| Molecular formula | C24H19F2N3O4S |
|---|---|
| Molecular weight | 483.5 g/mol |
| IUPAC name | (3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-11-hydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
| InChIKey | FIDLLEYNNRGVFR-CTNGQTDRSA-N |
| SMILES | C1COC[C@@H]2N1C(=O)C3=C(C(=O)C=CN3N2[C@H]4C5=C(CSC6=CC=CC=C46)C(=C(C=C5)F)F)O |
Computed by PubChem (NCBI)