cas: 10364-94-0 — see every product listed under this CAS number, including other names
(1H-Imidazol-1-yl)(phenyl)methanone, 95%, 95% (CAS 10364-94-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114SQR-100mg |
| cas | 10364-94-0 |
| size | 100mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 419.60 Pln | |
| Chemat | 25g | 1274.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Imidazol-1-yl(phenyl)methanone (CAS 10364-94-0) is a chemical compound with the molecular formula C10H8N2O and a molecular weight of 172.18 g/mol. IUPAC name: imidazol-1-yl(phenyl)methanone. InChIKey: JEGIFBGJZPYMJS-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | imidazol-1-yl(phenyl)methanone |
| InChIKey | JEGIFBGJZPYMJS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N2C=CN=C2 |
Computed by PubChem (NCBI)