CAS 124808-78-2 appears in our catalog under these names: 3-Isocyanato-1-methyl-1h-indole, 95%, 3-Isocyanato-1-methyl-1H-indole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg.
3-isocyanato-1-methylindole (CAS 124808-78-2) is a chemical compound with the molecular formula C10H8N2O and a molecular weight of 172.18 g/mol. IUPAC name: 3-isocyanato-1-methylindole. InChIKey: KONDNSIYLUAZFI-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | 3-isocyanato-1-methylindole |
| InChIKey | KONDNSIYLUAZFI-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)N=C=O |
Computed by PubChem (NCBI)