cas: 1055961-36-8 — see every product listed under this CAS number, including other names
(1R)-6-Bromo-2,3-dihydro-1h-inden-1-amine, 95% (CAS 1055961-36-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Combi-blocks, AmBeed, Chemat, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | QE-5301-250mg |
| cas | 1055961-36-8 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| AmBeed | 5g | 20088.25 Pln | |
| Ambeed | 100mg | 854.31 Pln | |
| Ambeed | 250mg | 1405.00 Pln | |
| Ambeed | 1g | 3496.50 Pln | |
| Chemat | 100mg | 688.40 Pln | |
| Chemat | 250mg | 1130.00 Pln | |
| Chemat | 1g | 2939.60 Pln | |
| BLDpharm | 100mg | 914.15 Pln | |
| BLDpharm | 250mg | 1508.38 Pln | |
| BLDpharm | 1g | 3768.70 Pln | |
| Fluorochem | 250mg | 2090.95 Pln | |
| Fluorochem | 1g | 5449.14 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
(1R)-6-bromo-2,3-dihydro-1H-inden-1-amine (CAS 1055961-36-8) is a chemical compound with the molecular formula C9H10BrN and a molecular weight of 212.09 g/mol. IUPAC name: (1R)-6-bromo-2,3-dihydro-1H-inden-1-amine. InChIKey: DUPHONQIBOZOHL-SECBINFHSA-N.
| Molecular formula | C9H10BrN |
|---|---|
| Molecular weight | 212.09 g/mol |
| IUPAC name | (1R)-6-bromo-2,3-dihydro-1H-inden-1-amine |
| InChIKey | DUPHONQIBOZOHL-SECBINFHSA-N |
| SMILES | C1CC2=C([C@@H]1N)C=C(C=C2)Br |
Computed by PubChem (NCBI)