CAS 1228561-27-0 appears in our catalog under these names: (1R)-5-Bromoindanylamine, 95%, (R)-5-Bromo-2,3-dihydro-1H-inden-1-amine 95%, (R)-5-Bromo-2,3-dihydro-1H-inden-1-amine, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg, 10g.
(1R)-5-bromo-2,3-dihydro-1H-inden-1-amine (CAS 1228561-27-0) is a chemical compound with the molecular formula C9H10BrN and a molecular weight of 212.09 g/mol. IUPAC name: (1R)-5-bromo-2,3-dihydro-1H-inden-1-amine. InChIKey: IEUKCNPRRGOGDG-SECBINFHSA-N.
| Molecular formula | C9H10BrN |
|---|---|
| Molecular weight | 212.09 g/mol |
| IUPAC name | (1R)-5-bromo-2,3-dihydro-1H-inden-1-amine |
| InChIKey | IEUKCNPRRGOGDG-SECBINFHSA-N |
| SMILES | C1CC2=C([C@@H]1N)C=CC(=C2)Br |
Computed by PubChem (NCBI)