cas: 13185-73-4 — see every product listed under this CAS number, including other names
(1R,1'R,2S,2'S,3R,3'R)-1,1'-(Pyrazine-2,5-diyl)bis(butane-1,2,3,4-tetraol), 98%, 98% (CAS 13185-73-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111ZTM-1mg |
| cas | 13185-73-4 |
| size | 1mg |
| availability | 0.005g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 366.80 Pln | |
| Chemat | 5mg | 1283.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(1R,2S,3R)-1-[5-[(1R,2S,3R)-1,2,3,4-tetrahydroxybutyl]pyrazin-2-yl]butane-1,2,3,4-tetrol (CAS 13185-73-4) is a chemical compound with the molecular formula C12H20N2O8 and a molecular weight of 320.30 g/mol. IUPAC name: (1R,2S,3R)-1-[5-[(1R,2S,3R)-1,2,3,4-tetrahydroxybutyl]pyrazin-2-yl]butane-1,2,3,4-tetrol. InChIKey: NPWQIVOYGNUVEB-PAUJSFGCSA-N.
| Molecular formula | C12H20N2O8 |
|---|---|
| Molecular weight | 320.30 g/mol |
| IUPAC name | (1R,2S,3R)-1-[5-[(1R,2S,3R)-1,2,3,4-tetrahydroxybutyl]pyrazin-2-yl]butane-1,2,3,4-tetrol |
| InChIKey | NPWQIVOYGNUVEB-PAUJSFGCSA-N |
| SMILES | C1=C(N=CC(=N1)[C@H]([C@@H]([C@@H](CO)O)O)O)[C@H]([C@@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)