CAS 13185-73-4 appears in our catalog under these names: Fructosazine, 10 mg, Fructosazine (Glucosamine EP Impurity B), Glucosamine EP Impurity B (Fructosazine), Fructosazine, >95% (HPLC), (1R,1'R,2S,2'S,3R,3'R)-1,1'-(Pyrazine-2,5-diyl)bis(butane-1,2,3,4-tetraol), 97%. Offered by: Roth, Chemat Brand, TRC, AmBeed, Biosynth. Available pack sizes: 10mg, on request, 100mg, 25mg, 0,025g, 0,01g, 50mg, 5mg.
(1R,2S,3R)-1-[5-[(1R,2S,3R)-1,2,3,4-tetrahydroxybutyl]pyrazin-2-yl]butane-1,2,3,4-tetrol (CAS 13185-73-4) is a chemical compound with the molecular formula C12H20N2O8 and a molecular weight of 320.30 g/mol. IUPAC name: (1R,2S,3R)-1-[5-[(1R,2S,3R)-1,2,3,4-tetrahydroxybutyl]pyrazin-2-yl]butane-1,2,3,4-tetrol. InChIKey: NPWQIVOYGNUVEB-PAUJSFGCSA-N.
| Molecular formula | C12H20N2O8 |
|---|---|
| Molecular weight | 320.30 g/mol |
| IUPAC name | (1R,2S,3R)-1-[5-[(1R,2S,3R)-1,2,3,4-tetrahydroxybutyl]pyrazin-2-yl]butane-1,2,3,4-tetrol |
| InChIKey | NPWQIVOYGNUVEB-PAUJSFGCSA-N |
| SMILES | C1=C(N=CC(=N1)[C@H]([C@@H]([C@@H](CO)O)O)O)[C@H]([C@@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)