cas: 644958-86-1 — see every product listed under this CAS number, including other names
(1R,2R)-N1,N2-Bis(3,3-dimethylbutyl)-N1,N2-dimethylcyclohexane-1,2-diamine 96% (CAS 644958-86-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A650658-100mg |
| cas | 644958-86-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 348.12 Pln | |
| Ambeed | 250mg | 492.75 Pln | |
| Ambeed | 1g | 1171.38 Pln | |
| Ambeed | 5g | 3980.44 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A650658 |
Trans-(1R,2R)-1-N,2-N-bis(3,3-dimethylbutyl)-1-N,2-N-dimethylcyclohexane-1,2-diamine (CAS 644958-86-1) is a chemical compound with the molecular formula C20H42N2 and a molecular weight of 310.6 g/mol. IUPAC name: trans-(1R,2R)-1-N,2-N-bis(3,3-dimethylbutyl)-1-N,2-N-dimethylcyclohexane-1,2-diamine. InChIKey: VGCWVKVNKNXOGZ-QZTJIDSGSA-N.
| Molecular formula | C20H42N2 |
|---|---|
| Molecular weight | 310.6 g/mol |
| IUPAC name | trans-(1R,2R)-1-N,2-N-bis(3,3-dimethylbutyl)-1-N,2-N-dimethylcyclohexane-1,2-diamine |
| InChIKey | VGCWVKVNKNXOGZ-QZTJIDSGSA-N |
| SMILES | CC(C)(C)CCN(C)[C@@H]1CCCC[C@H]1N(C)CCC(C)(C)C |
Computed by PubChem (NCBI)