cas: 1389359-96-9 — see every product listed under this CAS number, including other names
(1R,2R,5S)-3-[(tert-butoxy)carbonyl]-3-azabicyclo[3.1.0]hexane-2-carboxylic acid, 97% (CAS 1389359-96-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F516951-100MG |
| cas | 1389359-96-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 653.95 Pln | |
| Fluorochem | 250mg | 1278.73 Pln | |
| Fluorochem | 500mg | 1955.58 Pln | |
| Fluorochem | 1g | 2486.64 Pln | |
| Fluorochem | 5g | 7307.86 Pln | |
| Fluorochem | 25g | 28992.93 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(1R,2R,5S)-3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azabicyclo[3.1.0]hexane-2-carboxylic acid (CAS 1389359-96-9) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: (1R,2R,5S)-3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azabicyclo[3.1.0]hexane-2-carboxylic acid. InChIKey: RTWMQNSZCUYSJJ-BWZBUEFSSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | (1R,2R,5S)-3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
| InChIKey | RTWMQNSZCUYSJJ-BWZBUEFSSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C[C@H]2[C@@H]1C(=O)O |
Computed by PubChem (NCBI)