CAS 74844-93-2 appears in our catalog under these names: (S)-2,5-Dihydro-pyrrole-1,2-dicarboxylic acid 1-tert-butyl ester 2-methyl ester, 96%, Boc-3,4-Dehydro-Pro-OMe 95% (stabilized with TBC), (S)-1-tert-Butyl 2-methyl 1H-pyrrole-1,2(2H,5H)-dicarboxylate, 98%, 98%, Methyl N-Boc-L-proline-3-ene, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 10g, 25g, 1g, 100mg, 100g, 500g.
1-O-tert-butyl 2-O-methyl (2S)-2,5-dihydropyrrole-1,2-dicarboxylate (CAS 74844-93-2) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S)-2,5-dihydropyrrole-1,2-dicarboxylate. InChIKey: YDQDZLXTPXNOKO-QMMMGPOBSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S)-2,5-dihydropyrrole-1,2-dicarboxylate |
| InChIKey | YDQDZLXTPXNOKO-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC=C[C@H]1C(=O)OC |
Computed by PubChem (NCBI)