cas: 190792-72-4 — see every product listed under this CAS number, including other names
(1R,2S)-2-Aminocyclohexanol hydrochloride 95% (CAS 190792-72-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A261554-100mg |
| cas | 190792-72-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 125.62 Pln | |
| Ambeed | 250mg | 142.31 Pln | |
| Ambeed | 1g | 159.00 Pln | |
| Ambeed | 5g | 453.81 Pln | |
| Ambeed | 25g | 1933.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A261554 |
Cis-(1R,2S)-2-aminocyclohexan-1-ol;hydrochloride (CAS 190792-72-4) is a chemical compound with the molecular formula C6H14ClNO and a molecular weight of 151.63 g/mol. IUPAC name: cis-(1R,2S)-2-aminocyclohexan-1-ol;hydrochloride. InChIKey: LKKCSUHCVGCGFA-RIHPBJNCSA-N.
| Molecular formula | C6H14ClNO |
|---|---|
| Molecular weight | 151.63 g/mol |
| IUPAC name | cis-(1R,2S)-2-aminocyclohexan-1-ol;hydrochloride |
| InChIKey | LKKCSUHCVGCGFA-RIHPBJNCSA-N |
| SMILES | C1CC[C@H]([C@H](C1)N)O.Cl |
Computed by PubChem (NCBI)