CAS 67459-74-9 appears in our catalog under these names: Cis-6-methylpiperidin-3-ol hydrochloride, 95%, cis-6-Methylpiperidin-3-ol hydrochloride, 97%, cis–6–Methylpiperidin–3–ol hydrochloride, cis-6-Methylpiperidin-3-ol hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 0,5g, 50mg.
(3S,6R)-6-methylpiperidin-3-ol;hydrochloride (CAS 67459-74-9) is a chemical compound with the molecular formula C6H14ClNO and a molecular weight of 151.63 g/mol. IUPAC name: (3S,6R)-6-methylpiperidin-3-ol;hydrochloride. InChIKey: PVOAKSPCPLYSNC-IBTYICNHSA-N.
| Molecular formula | C6H14ClNO |
|---|---|
| Molecular weight | 151.63 g/mol |
| IUPAC name | (3S,6R)-6-methylpiperidin-3-ol;hydrochloride |
| InChIKey | PVOAKSPCPLYSNC-IBTYICNHSA-N |
| SMILES | C[C@@H]1CC[C@@H](CN1)O.Cl |
Computed by PubChem (NCBI)