(1R,2S)-rel-2-Phenylcyclopropanecarboxylic acid, 95%
cas: 939-89-9 — see every product listed under this CAS number, including other names
(1R,2S)-rel-2-Phenylcyclopropanecarboxylic acid, 95% (CAS 939-89-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A153320-250mg |
| cas | 939-89-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1199.19 Pln | |
| Ambeed | 5g | 4586.75 Pln | |
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 309.20 Pln | |
| Chemat | 1g | 794.00 Pln | |
| Chemat | 5g | 3722.00 Pln | |
| BLDpharm | 100mg | 325.47 Pln | |
| BLDpharm | 250mg | 580.93 Pln | |
| BLDpharm | 1g | 1175.17 Pln | |
| BLDpharm | 5g | 4496.22 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Cis-(1R,2S)-2-phenylcyclopropane-1-carboxylic acid (CAS 939-89-9) is a chemical compound with the molecular formula C10H10O2 and a molecular weight of 162.18 g/mol. IUPAC name: cis-(1R,2S)-2-phenylcyclopropane-1-carboxylic acid. InChIKey: AHDDRJBFJBDEPW-RKDXNWHRSA-N.
| Molecular formula | C10H10O2 |
|---|---|
| Molecular weight | 162.18 g/mol |
| IUPAC name | cis-(1R,2S)-2-phenylcyclopropane-1-carboxylic acid |
| InChIKey | AHDDRJBFJBDEPW-RKDXNWHRSA-N |
| SMILES | C1[C@@H]([C@@H]1C(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
(1R,2S)-2-phenylcyclopropane-1-carboxylic acid, (1r,2s)-2-phenylcyclopropanecarboxylic acid, Cyclopropanecarboxylic acid, 2-phenyl-, (1R-cis)-, 2-Phenyl-1-cyclopropanecarboxylic acid, cis-(-)-, 2-Phenyl-1-cyclopropanecarboxylic acid, (1R-cis)-, Cyclopropanecarboxylic acid, 2-phenyl-, (1R,2S)-, (1R,2S)-rel-2-Phenylcyclopropanecarboxylic acid, cis-2-phenylcyclopropane-1-carboxylic acid, cis-2-Phenylcyclopropanecarboxylicacid, cis-2-phenylcyclopropane-carboxylic acid