CAS 23020-15-7 appears in our catalog under these names: (1S,2S)-2-Phenylcyclopropane-1-carboxylic acid, 95%, (1S,2S)–2–Phenylcyclopropanecarboxylic acid, (1S,2S)-2-Phenylcyclopropane-1-carboxylic acid, (1S,2S)-2-Phenylcyclopropanecarboxylic acid 98%, (1S,2S)-2-Phenylcyclopropanecarboxylic Acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 10g, 5g, 1g, 2,5g, 25g, 500mg.
Trans-(1S,2S)-2-phenylcyclopropane-1-carboxylic acid (CAS 23020-15-7) is a chemical compound with the molecular formula C10H10O2 and a molecular weight of 162.18 g/mol. IUPAC name: trans-(1S,2S)-2-phenylcyclopropane-1-carboxylic acid. InChIKey: AHDDRJBFJBDEPW-BDAKNGLRSA-N.
| Molecular formula | C10H10O2 |
|---|---|
| Molecular weight | 162.18 g/mol |
| IUPAC name | trans-(1S,2S)-2-phenylcyclopropane-1-carboxylic acid |
| InChIKey | AHDDRJBFJBDEPW-BDAKNGLRSA-N |
| SMILES | C1[C@@H]([C@H]1C(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)