cas: 1051393-66-8 — see every product listed under this CAS number, including other names
(1R,2S,5S)-3-(tert-Butoxycarbonyl)-3-azabicyclo[3.1.0]hexane-2-carboxylic acid, 97% (CAS 1051393-66-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F448017-100MG |
| cas | 1051393-66-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1377.66 Pln | |
| Fluorochem | 250mg | 2122.19 Pln | |
| Fluorochem | 1g | 5777.15 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(1S,2R,5R)-3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azabicyclo[3.1.0]hexane-2-carboxylic acid (CAS 1051393-66-8) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: (1S,2R,5R)-3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azabicyclo[3.1.0]hexane-2-carboxylic acid. InChIKey: RTWMQNSZCUYSJJ-BIIVOSGPSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | (1S,2R,5R)-3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
| InChIKey | RTWMQNSZCUYSJJ-BIIVOSGPSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2C[C@@H]2[C@@H]1C(=O)O |
Computed by PubChem (NCBI)