cas: 1403763-25-6 — see every product listed under this CAS number, including other names
(1R,4R)-2-methyl-2,5-diazabicyclo[2.2.1]heptane dihydrochloride, 97% (CAS 1403763-25-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F519880-5G |
| cas | 1403763-25-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 2002.44 Pln | |
| Fluorochem | 250mg | 268.67 Pln | |
| Fluorochem | 1g | 565.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(1R,4R)-2-methyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride (CAS 1403763-25-6) is a chemical compound with the molecular formula C6H14Cl2N2 and a molecular weight of 185.09 g/mol. IUPAC name: (1R,4R)-2-methyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride. InChIKey: CPKLWCPJBAELNP-BNTLRKBRSA-N.
| Molecular formula | C6H14Cl2N2 |
|---|---|
| Molecular weight | 185.09 g/mol |
| IUPAC name | (1R,4R)-2-methyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride |
| InChIKey | CPKLWCPJBAELNP-BNTLRKBRSA-N |
| SMILES | CN1C[C@H]2C[C@@H]1CN2.Cl.Cl |
Computed by PubChem (NCBI)