CAS 108796-57-2 appears in our catalog under these names: Trans-4-cyclohexene-1,2-diamine dihydrochloride, 95%, trans-Cyclohex-4-ene-1,2-diamine dihydrochloride, 97%, TRANS-4-CYCLOHEXENE-1,2-DIAMINE DIHYDROC. Offered by: Combi-blocks, AmBeed, Sigma-Aldrich. Available pack sizes: 1g, 50mg.
(1R,2R)-cyclohex-4-ene-1,2-diamine;dihydrochloride (CAS 108796-57-2) is a chemical compound with the molecular formula C6H14Cl2N2 and a molecular weight of 185.09 g/mol. IUPAC name: (1R,2R)-cyclohex-4-ene-1,2-diamine;dihydrochloride. InChIKey: UQRRHSHMGMLJDM-BNTLRKBRSA-N.
| Molecular formula | C6H14Cl2N2 |
|---|---|
| Molecular weight | 185.09 g/mol |
| IUPAC name | (1R,2R)-cyclohex-4-ene-1,2-diamine;dihydrochloride |
| InChIKey | UQRRHSHMGMLJDM-BNTLRKBRSA-N |
| SMILES | C1C=CC[C@H]([C@@H]1N)N.Cl.Cl |
Computed by PubChem (NCBI)